CAS 618-80-4 appears in our catalog under these names: 2,6–Dichloro–4–nitrophenol, 2,6-Dichloro-4-nitrophenol, 2,6-Dichloro-4-nitrophenol, 98%, 2,6-Dichloro-4-nitrophenol, >98.0%(HPLC), 2,6-Dichloro-4-nitrophenol, 98%, 98%. Offered by: GLPBio, Chemat, HPC Standards, Combi-blocks, Fluorochem. Available pack sizes: 100g, 500g, 25g, 1x1000mg, 5g, 1g.
2,6-dichloro-4-nitrophenol (CAS 618-80-4) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 2,6-dichloro-4-nitrophenol. InChIKey: PXSGFTWBZNPNIC-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 2,6-dichloro-4-nitrophenol |
| InChIKey | PXSGFTWBZNPNIC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)