CAS 1806356-80-8 is the registry number for 2,3-Dichloro-5-nitrophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,3-dichloro-5-nitrophenol (CAS 1806356-80-8) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 2,3-dichloro-5-nitrophenol. InChIKey: XZPYWSMHAVVJNK-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 2,3-dichloro-5-nitrophenol |
| InChIKey | XZPYWSMHAVVJNK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)