cas: 1256835-40-1 — see every product listed under this CAS number, including other names
2,6-Dichloro-3-methylisonicotinic acid, 95%, 95% (CAS 1256835-40-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110Y0A-100mg |
| cas | 1256835-40-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 250mg | 659.60 Pln | |
| Chemat | 1g | 1696.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-3-methylpyridine-4-carboxylic acid (CAS 1256835-40-1) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 2,6-dichloro-3-methylpyridine-4-carboxylic acid. InChIKey: TWYNDQHXDSFICB-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 2,6-dichloro-3-methylpyridine-4-carboxylic acid |
| InChIKey | TWYNDQHXDSFICB-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C=C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)