cas: 287196-80-9 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-(piperidin-1-ylcarbonyl)pyridine, 98%, 98% (CAS 287196-80-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113W03-50mg |
| cas | 287196-80-9 |
| size | 50mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 98.00 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 914.00 Pln | |
| Chemat | 25g | 3035.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,6-dichloro-4-pyridinyl)-piperidin-1-ylmethanone (CAS 287196-80-9) is a chemical compound with the molecular formula C11H12Cl2N2O and a molecular weight of 259.13 g/mol. IUPAC name: (2,6-dichloro-4-pyridinyl)-piperidin-1-ylmethanone. InChIKey: RHHFYTMPVURVTP-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | (2,6-dichloro-4-pyridinyl)-piperidin-1-ylmethanone |
| InChIKey | RHHFYTMPVURVTP-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC(=NC(=C2)Cl)Cl |
Computed by PubChem (NCBI)