Products 494778-29-9
CAS 494778-29-9 is the registry number for (3,5-Dichlorophenyl)(piperazin-1-yl)methanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3,5-dichlorophenyl)-piperazin-1-ylmethanone (CAS 494778-29-9) is a chemical compound with the molecular formula C11H12Cl2N2O and a molecular weight of 259.13 g/mol. IUPAC name: (3,5-dichlorophenyl)-piperazin-1-ylmethanone. InChIKey: ZJKSUVLQJYIQPY-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | (3,5-dichlorophenyl)-piperazin-1-ylmethanone |
| InChIKey | ZJKSUVLQJYIQPY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)