CAS 55470-74-1 appears in our catalog under these names: 1,3-Bis(2-chloroethyl)-1H-benzo[d]imidazol-2(3H)-one, 95%, Flibanserin Impurity 5, 1,3-bis(2-chloroethyl)benzimidazolin-2-one, 98%, 98%. Offered by: Chemat Brand, Hubei YoungXin, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1,3-bis(2-chloroethyl)benzimidazol-2-one (CAS 55470-74-1) is a chemical compound with the molecular formula C11H12Cl2N2O and a molecular weight of 259.13 g/mol. IUPAC name: 1,3-bis(2-chloroethyl)benzimidazol-2-one. InChIKey: ISLCAAJTFWKTII-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | 1,3-bis(2-chloroethyl)benzimidazol-2-one |
| InChIKey | ISLCAAJTFWKTII-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C(=O)N2CCCl)CCCl |
Computed by PubChem (NCBI)