2,6-Dichloro-4-fluorobenzaldehyde 95%
cas: 1182709-86-9 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-fluorobenzaldehyde 95% (CAS 1182709-86-9) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A130632-500g |
| cas | 1182709-86-9 |
| size | 500g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 22192.06 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 426.00 Pln | |
| Ambeed | 10g | 776.44 Pln | |
| Ambeed | 25g | 1744.31 Pln | |
| Ambeed | 100g | 5599.12 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A130632 |
2,6-dichloro-4-fluorobenzaldehyde (CAS 1182709-86-9) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2,6-dichloro-4-fluorobenzaldehyde. InChIKey: UOQMGQYMDHYXTB-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2,6-dichloro-4-fluorobenzaldehyde |
| InChIKey | UOQMGQYMDHYXTB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C=O)Cl)F |
Computed by PubChem (NCBI)