cas: 25194-01-8 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-nitropyridine 97% (CAS 25194-01-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A152200-250mg |
| cas | 25194-01-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 348.12 Pln | |
| Ambeed | 100g | 1176.94 Pln | |
| Ambeed | 500g | 4981.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A152200 |
2,6-dichloro-4-nitropyridine (CAS 25194-01-8) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,6-dichloro-4-nitropyridine. InChIKey: BZYQSSVTQJTUDD-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,6-dichloro-4-nitropyridine |
| InChIKey | BZYQSSVTQJTUDD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)