cas: 25194-01-8 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-nitropyridine, 98% (CAS 25194-01-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F067319-1G |
| cas | 25194-01-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 325.94 Pln | |
| Fluorochem | 100g | 1127.75 Pln | |
| Fluorochem | 500g | 4912.87 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,6-dichloro-4-nitropyridine (CAS 25194-01-8) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,6-dichloro-4-nitropyridine. InChIKey: BZYQSSVTQJTUDD-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,6-dichloro-4-nitropyridine |
| InChIKey | BZYQSSVTQJTUDD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)