cas: 25185-95-9 — see every product listed under this CAS number, including other names
2,6-Dichloro-benzaldehyde oxime, 98% (CAS 25185-95-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F317461-1G |
| cas | 25185-95-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 10g | 310.33 Pln | |
| Fluorochem | 25g | 419.66 Pln | |
| Fluorochem | 50g | 690.40 Pln | |
| Fluorochem | 100g | 903.87 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-[(2,6-dichlorophenyl)methylidene]hydroxylamine (CAS 25185-95-9) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: N-[(2,6-dichlorophenyl)methylidene]hydroxylamine. InChIKey: YBSXDWIAUZOFFV-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | N-[(2,6-dichlorophenyl)methylidene]hydroxylamine |
| InChIKey | YBSXDWIAUZOFFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C=NO)Cl |
Computed by PubChem (NCBI)