2,6-Dichlorobenzaldehyde oxime, 98%
cas: 25185-95-9 — see every product listed under this CAS number, including other names
2,6-Dichlorobenzaldehyde oxime, 98% (CAS 25185-95-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A485601-1g |
| cas | 25185-95-9 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 259.12 Pln | |
| Ambeed | 25g | 459.38 Pln | |
| Ambeed | 100g | 993.38 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 198.80 Pln | |
| Chemat | 25g | 347.60 Pln | |
| Chemat | 100g | 736.40 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 10g | 275.48 Pln | |
| BLDpharm | 25g | 492.07 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
N-[(2,6-dichlorophenyl)methylidene]hydroxylamine (CAS 25185-95-9) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: N-[(2,6-dichlorophenyl)methylidene]hydroxylamine. InChIKey: YBSXDWIAUZOFFV-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | N-[(2,6-dichlorophenyl)methylidene]hydroxylamine |
| InChIKey | YBSXDWIAUZOFFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C=NO)Cl |
Computed by PubChem (NCBI)
