2,6-Dichloropurine, 97%
cas: 5451-40-1 — see every product listed under this CAS number, including other names
2,6-Dichloropurine, 97% (CAS 5451-40-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10G, 25g, 100g, 500g, 1kg. Offered by: Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 113700050 |
| cas | 5451-40-1 |
| size | 5g |
| availability | availability |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 350.12 Pln | |
| Thermo Scientific (Acros) | 1g | 134.08 Pln | |
| Sigma-Aldrich | 10G | 993.00 Pln | |
| Sigma-Aldrich | 1G | 987.00 Pln | |
| Sigma-Aldrich | 5G | 4730.00 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 195.78 Pln | |
| Fluorochem | 100g | 461.31 Pln | |
| Fluorochem | 500g | 2023.26 Pln | |
| Fluorochem | 1kg | 3949.67 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2,6-dichloro-7H-purine (CAS 5451-40-1) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 2,6-dichloro-7H-purine. InChIKey: RMFWVOLULURGJI-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 2,6-dichloro-7H-purine |
| InChIKey | RMFWVOLULURGJI-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)