cas: 16492-28-7 — see every product listed under this CAS number, including other names
2,6-Dichloropyrimidine-4-carboxylic acid, 98%, 98% (CAS 16492-28-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112V70-100mg |
| cas | 16492-28-7 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 309.20 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 50g | 1442.00 Pln | |
| Chemat | 100g | 2680.40 Pln | |
| Chemat | 250g | 4115.60 Pln | |
| Chemat | 500g | 7876.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloropyrimidine-4-carboxylic acid (CAS 16492-28-7) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,6-dichloropyrimidine-4-carboxylic acid. InChIKey: MOXUTXQEKYPKKS-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,6-dichloropyrimidine-4-carboxylic acid |
| InChIKey | MOXUTXQEKYPKKS-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(N=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)