cas: 16492-28-7 — see every product listed under this CAS number, including other names
2,6-Dichloropyrimidine-4-carboxylic acid, 97% (CAS 16492-28-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044308-250MG |
| cas | 16492-28-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 502.97 Pln | |
| Fluorochem | 10g | 893.45 Pln | |
| Fluorochem | 25g | 1955.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,6-dichloropyrimidine-4-carboxylic acid (CAS 16492-28-7) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,6-dichloropyrimidine-4-carboxylic acid. InChIKey: MOXUTXQEKYPKKS-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,6-dichloropyrimidine-4-carboxylic acid |
| InChIKey | MOXUTXQEKYPKKS-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(N=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)