2,6-Dichloropyrimidine-4-carboxylic acid, 97%
cas: 16492-28-7 — see every product listed under this CAS number, including other names
2,6-Dichloropyrimidine-4-carboxylic acid, 97% (CAS 16492-28-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A648913-1g |
| cas | 16492-28-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 481.62 Pln | |
| Ambeed | 10g | 820.94 Pln | |
| Ambeed | 25g | 1939.00 Pln | |
| Ambeed | 100g | 5048.44 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 514.29 Pln | |
| BLDpharm | 10g | 875.27 Pln | |
| BLDpharm | 25g | 2074.85 Pln | |
| BLDpharm | 100g | 5440.33 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2,6-dichloropyrimidine-4-carboxylic acid (CAS 16492-28-7) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,6-dichloropyrimidine-4-carboxylic acid. InChIKey: MOXUTXQEKYPKKS-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,6-dichloropyrimidine-4-carboxylic acid |
| InChIKey | MOXUTXQEKYPKKS-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(N=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)
