2,6-Difluoro-3-methoxybenzoic acid, 98%
cas: 886498-30-2 — see every product listed under this CAS number, including other names
2,6-Difluoro-3-methoxybenzoic acid, 98% (CAS 886498-30-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F035764-250MG |
| cas | 886498-30-2 |
| size | 250mg |
| availability | In Stock UK |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 25g | 1299.56 Pln | |
| Fluorochem | 100g | 4038.18 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 25g | 1126.88 Pln | |
| Ambeed | 100g | 3947.06 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
2,6-difluoro-3-methoxybenzoic acid (CAS 886498-30-2) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2,6-difluoro-3-methoxybenzoic acid. InChIKey: YYZBRPSJLASNKL-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2,6-difluoro-3-methoxybenzoic acid |
| InChIKey | YYZBRPSJLASNKL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)C(=O)O)F |
Computed by PubChem (NCBI)