2,6-Difluoro-4-nitrophenol, 97%
cas: 658-07-1 — see every product listed under this CAS number, including other names
2,6-Difluoro-4-nitrophenol, 97% (CAS 658-07-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 100mg, 250mg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F076162-1G |
| cas | 658-07-1 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 10g | 825.77 Pln | |
| Fluorochem | 25g | 1809.80 Pln | |
| Fluorochem | 100g | 6334.25 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 10g | 576.19 Pln | |
| Ambeed | 25g | 1238.12 Pln | |
| Ambeed | 100g | 4275.25 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
2,6-difluoro-4-nitrophenol (CAS 658-07-1) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 2,6-difluoro-4-nitrophenol. InChIKey: KVVXRISUSPIMLJ-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 2,6-difluoro-4-nitrophenol |
| InChIKey | KVVXRISUSPIMLJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)