cas: 59189-51-4 — see every product listed under this CAS number, including other names
2,6-Difluorobenzophenone, ≥98%, ≥98% (CAS 59189-51-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G5I-5g |
| cas | 59189-51-4 |
| size | 5g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 462.80 Pln | |
| Chemat | 25g | 1600.40 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(2,6-difluorophenyl)-phenylmethanone (CAS 59189-51-4) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: (2,6-difluorophenyl)-phenylmethanone. InChIKey: KTRGJHDNHIPMEY-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (2,6-difluorophenyl)-phenylmethanone |
| InChIKey | KTRGJHDNHIPMEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)