CAS 85068-28-6 appears in our catalog under these names: 2,6–Difluorophenylacetic acid, 2,6-Difluorophenylacetic acid, 98% , 2,6-Difluorophenylacetic Acid, >98.0%(GC)(T), 2,6-Difluorophenylacetic acid, 97%, 97%, 2,6-Difluorophenylacetic acid. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat, HPC Standards. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g, 1x100mg.
2-(2,6-difluorophenyl)acetic acid (CAS 85068-28-6) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 2-(2,6-difluorophenyl)acetic acid. InChIKey: FUGDCKXBUZFEON-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)acetic acid |
| InChIKey | FUGDCKXBUZFEON-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CC(=O)O)F |
Computed by PubChem (NCBI)