2,6-Dimethoxyanthracene, 95%
cas: 36319-03-6 — see every product listed under this CAS number, including other names
2,6-Dimethoxyanthracene, 95% (CAS 36319-03-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A254691-250mg |
| cas | 36319-03-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 971.12 Pln | |
| Ambeed | 5g | 3274.00 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 818.00 Pln | |
| BLDpharm | 100mg | 375.45 Pln | |
| BLDpharm | 250mg | 514.29 Pln | |
| BLDpharm | 1g | 1186.27 Pln | |
| BLDpharm | 5g | 3552.11 Pln | |
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 1g | 992.38 Pln | |
| Fluorochem | 5g | 3335.30 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2,6-dimethoxyanthracene (CAS 36319-03-6) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 2,6-dimethoxyanthracene. InChIKey: QCFQYVMTVPXVKG-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 2,6-dimethoxyanthracene |
| InChIKey | QCFQYVMTVPXVKG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC3=C(C=C2C=C1)C=C(C=C3)OC |
Computed by PubChem (NCBI)