CAS 495-71-6 appears in our catalog under these names: 1,2-Dibenzoylethane, 98%, Succinophenone (Diphenacyl), 1,2-Dibenzoylethane, 98+% , 1,4-Diphenylbutane-1,4-dione, 98%, 98%, 1,4-Diphenyl-1,4-butanedione, 98%. Offered by: Combi-blocks, Mikromol, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25mg, 100mg, 250mg, 10g, 25g, 100g.
1,4-diphenylbutane-1,4-dione (CAS 495-71-6) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 1,4-diphenylbutane-1,4-dione. InChIKey: OSWWFLDIIGGSJV-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 1,4-diphenylbutane-1,4-dione |
| InChIKey | OSWWFLDIIGGSJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CCC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)