CAS 28320-62-9 appears in our catalog under these names: 9,9-Dimethylfluorene-2-carboxylic acid, 95%, 9,9–Dimethylfluorene–2–carboxylic Acid, 9,9-Dimethylfluorene-2-carboxylic Acid, >98.0%(GC)(T), 9,9-Dimethyl-9H-fluorene-2-carboxylic acid, 95+%, 95+%, 9,9-Dimethyl-9h-fluorene-2-carboxylic acid, 95%+,RG. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 100mg, 250mg.
9,9-dimethylfluorene-2-carboxylic acid (CAS 28320-62-9) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 9,9-dimethylfluorene-2-carboxylic acid. InChIKey: SJIBSIBHNJAUOR-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 9,9-dimethylfluorene-2-carboxylic acid |
| InChIKey | SJIBSIBHNJAUOR-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)C(=O)O)C |
Computed by PubChem (NCBI)