CAS 59411-15-3 appears in our catalog under these names: 1-(3,4-Dimethylphenyl)-2-phenylethane-1,2-dione, 95%, 1-(3,4-Dimethylphenyl)-2-phenylethane-1,2-dione, 95+%, 1-(3,4-Dimethylphenyl)-2-phenylethane-1,2-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
1-(3,4-dimethylphenyl)-2-phenylethane-1,2-dione (CAS 59411-15-3) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)-2-phenylethane-1,2-dione. InChIKey: UJARQLWFLLIFBN-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)-2-phenylethane-1,2-dione |
| InChIKey | UJARQLWFLLIFBN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)