Products 1799412-42-2
CAS 1799412-42-2 is the registry number for 4-(1-(O-Tolyl)vinyl)benzoic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
4-[1-(2-methylphenyl)ethenyl]benzoic acid (CAS 1799412-42-2) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 4-[1-(2-methylphenyl)ethenyl]benzoic acid. InChIKey: KMUWACOLXILRKG-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 4-[1-(2-methylphenyl)ethenyl]benzoic acid |
| InChIKey | KMUWACOLXILRKG-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=C)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)