CAS 22837-75-8 appears in our catalog under these names: (2E)-3-[1,1'-Biphenyl]-4-yl-2-propenoic acid, methyl ester, 98%, (E)–Methyl 3–((1,1'–biphenyl)–4–yl)acrylate, (E)-Methyl 3-([1,1'-biphenyl]-4-yl)acrylate, 98%, 98%, Methyl (e)-3-([1,1'-biphenyl]-4-yl)acrylate, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
Methyl (E)-3-(4-phenylphenyl)prop-2-enoate (CAS 22837-75-8) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: methyl (E)-3-(4-phenylphenyl)prop-2-enoate. InChIKey: UHUGJJAYJFINJA-FMIVXFBMSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | methyl (E)-3-(4-phenylphenyl)prop-2-enoate |
| InChIKey | UHUGJJAYJFINJA-FMIVXFBMSA-N |
| SMILES | COC(=O)/C=C/C1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)