CAS 78326-88-2 is the registry number for 5-(Benzyloxy)-2,3-dihydro-1h-inden-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
5-phenylmethoxy-2,3-dihydroinden-1-one (CAS 78326-88-2) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 5-phenylmethoxy-2,3-dihydroinden-1-one. InChIKey: LYTKODVZMLEVSA-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 5-phenylmethoxy-2,3-dihydroinden-1-one |
| InChIKey | LYTKODVZMLEVSA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=C(C=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)