cas: 221006-70-8 — see every product listed under this CAS number, including other names
2,6-Dimethoxypyridine-3-boronic acid 97% (CAS 221006-70-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A205168-1g |
| cas | 221006-70-8 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 515.00 Pln | |
| Ambeed | 100g | 1844.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A205168 |
(2,6-dimethoxy-3-pyridinyl)boronic acid (CAS 221006-70-8) is a chemical compound with the molecular formula C7H10BNO4 and a molecular weight of 182.97 g/mol. IUPAC name: (2,6-dimethoxy-3-pyridinyl)boronic acid. InChIKey: ADGHSWFUZUADDH-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO4 |
|---|---|
| Molecular weight | 182.97 g/mol |
| IUPAC name | (2,6-dimethoxy-3-pyridinyl)boronic acid |
| InChIKey | ADGHSWFUZUADDH-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)OC)OC)(O)O |
Computed by PubChem (NCBI)