Products 2225153-58-0
CAS 2225153-58-0 is the registry number for 2–Cyano–2–(ethoxycarbonyl)cyclopropyl boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
(2-cyano-2-ethoxycarbonylcyclopropyl)boronic acid (CAS 2225153-58-0) is a chemical compound with the molecular formula C7H10BNO4 and a molecular weight of 182.97 g/mol. IUPAC name: (2-cyano-2-ethoxycarbonylcyclopropyl)boronic acid. InChIKey: AZHNRXCGPOKKJC-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO4 |
|---|---|
| Molecular weight | 182.97 g/mol |
| IUPAC name | (2-cyano-2-ethoxycarbonylcyclopropyl)boronic acid |
| InChIKey | AZHNRXCGPOKKJC-UHFFFAOYSA-N |
| SMILES | B(C1CC1(C#N)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)