Products 221006-70-8

CAS 221006-70-8 appears in our catalog under these names: 2,6–Dimethoxy–3–pyridineboronic acid, 2,6-Dimethoxypyridine-5-boronic acid/ 95+%, 2,6-Dimethoxypyridine-3-boronic Acid (contains varying amounts of Anhydride), 2,6-Dimethoxypyridine-3-boronic acid 97%, 2,6-Dimethoxypyridin-3-ylboronic acid, 97%, 97%. Offered by: GLPBio, Chemat, TCI, Ambeed, MedChemExpress. Available pack sizes: 25g, 1g, 5g, 10g, 100g, 250mg, 25 g, 10 g.

Structural formula: {0} (CAS {1})

(2,6-dimethoxy-3-pyridinyl)boronic acid (CAS 221006-70-8) is a chemical compound with the molecular formula C7H10BNO4 and a molecular weight of 182.97 g/mol. IUPAC name: (2,6-dimethoxy-3-pyridinyl)boronic acid. InChIKey: ADGHSWFUZUADDH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10BNO4
Molecular weight182.97 g/mol
IUPAC name(2,6-dimethoxy-3-pyridinyl)boronic acid
InChIKeyADGHSWFUZUADDH-UHFFFAOYSA-N
SMILESB(C1=C(N=C(C=C1)OC)OC)(O)O

Computed by PubChem (NCBI)