CAS 1104636-73-8 appears in our catalog under these names: 4-Methyl-8-vinyldihydro-4l4,8l4-(1,3,2)oxazaborolo(2,3-b)(1,3,2)oxazaborole-2,6(3H,5H)-dione, 97%, Vinylboronic acid MIDA ester, 4-Methyl-8-vinyldihydro-4l4,8l4-[1,3,2]oxazaborolo[2,3-b][1,3,2]oxazaborole-2,6(3H,5H)-dione 95%, VINYLBORONIC ACID MIDA ESTER, 97%, Vinylboronic acid MIDA ester, 95%, 95%. Offered by: AmBeed, Biosynth, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 50g, 250mg, 1g, 100mg.
2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1104636-73-8) is a chemical compound with the molecular formula C7H10BNO4 and a molecular weight of 182.97 g/mol. IUPAC name: 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: MGRQGYAVASCCAK-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO4 |
|---|---|
| Molecular weight | 182.97 g/mol |
| IUPAC name | 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | MGRQGYAVASCCAK-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C=C |
Computed by PubChem (NCBI)