cas: 32890-88-3 — see every product listed under this CAS number, including other names
2,6-difluoro-3-methylbenzoic acid, 98%, 98% (CAS 32890-88-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114B6N-10g |
| cas | 32890-88-3 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 376.40 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 218.00 Pln | |
| Chemat | 25g | 851.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-difluoro-3-methylbenzoic acid (CAS 32890-88-3) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 2,6-difluoro-3-methylbenzoic acid. InChIKey: QZIVNVIPFGKDQE-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2,6-difluoro-3-methylbenzoic acid |
| InChIKey | QZIVNVIPFGKDQE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C(=O)O)F |
Computed by PubChem (NCBI)