cas: 1341345-20-7 — see every product listed under this CAS number, including other names
2,7,8-Trichloroquinoline, 95% (CAS 1341345-20-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Chemat, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1029073-5g |
| cas | 1341345-20-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8858.50 Pln | |
| Chemat | 100mg | 827.60 Pln | |
| Chemat | 250mg | 1154.00 Pln | |
| Chemat | 500mg | 1782.80 Pln | |
| Chemat | 1g | 2267.60 Pln | |
| Fluorochem | 100mg | 1054.85 Pln | |
| Fluorochem | 250mg | 1476.58 Pln | |
| Fluorochem | 500mg | 2278.38 Pln | |
| Fluorochem | 1g | 2897.96 Pln | |
| Fluorochem | 5g | 8021.15 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,7,8-trichloroquinoline (CAS 1341345-20-7) is a chemical compound with the molecular formula C9H4Cl3N and a molecular weight of 232.5 g/mol. IUPAC name: 2,7,8-trichloroquinoline. InChIKey: GMWMBZACFDXEKV-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3N |
|---|---|
| Molecular weight | 232.5 g/mol |
| IUPAC name | 2,7,8-trichloroquinoline |
| InChIKey | GMWMBZACFDXEKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CC(=N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)