cas: 1380331-15-6 — see every product listed under this CAS number, including other names
2,7-DIBROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE, 98% (CAS 1380331-15-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F304202-50MG |
| cas | 1380331-15-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 450.90 Pln | |
| Fluorochem | 100mg | 737.26 Pln | |
| Fluorochem | 250mg | 1028.82 Pln | |
| Fluorochem | 500mg | 1580.71 Pln | |
| Fluorochem | 1g | 2012.85 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,7-dibromo-[1,2,4]triazolo[1,5-a]pyridine (CAS 1380331-15-6) is a chemical compound with the molecular formula C6H3Br2N3 and a molecular weight of 276.92 g/mol. IUPAC name: 2,7-dibromo-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: NCONOGCFMPPUSQ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2N3 |
|---|---|
| Molecular weight | 276.92 g/mol |
| IUPAC name | 2,7-dibromo-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | NCONOGCFMPPUSQ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)Br)C=C1Br |
Computed by PubChem (NCBI)