cas: 1380331-15-6 — see every product listed under this CAS number, including other names
2,7-Dibromo-(1,2,4)triazolo(1,5-a)pyridine, 98% (CAS 1380331-15-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A931593-1g |
| cas | 1380331-15-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 3220.84 Pln | |
| AmBeed | 5g | 15811.18 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,7-dibromo-[1,2,4]triazolo[1,5-a]pyridine (CAS 1380331-15-6) is a chemical compound with the molecular formula C6H3Br2N3 and a molecular weight of 276.92 g/mol. IUPAC name: 2,7-dibromo-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: NCONOGCFMPPUSQ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2N3 |
|---|---|
| Molecular weight | 276.92 g/mol |
| IUPAC name | 2,7-dibromo-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | NCONOGCFMPPUSQ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)Br)C=C1Br |
Computed by PubChem (NCBI)