cas: 4733-39-5 — see every product listed under this CAS number, including other names
2,9-Dimethyl-4,7-diphenyl-1,10-phenanthroline, 97% (CAS 4733-39-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235890-1G |
| cas | 4733-39-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 497.76 Pln | |
| Fluorochem | 25g | 997.58 Pln | |
| Fluorochem | 100g | 3814.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline (CAS 4733-39-5) is a chemical compound with the molecular formula C26H20N2 and a molecular weight of 360.4 g/mol. IUPAC name: 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline. InChIKey: STTGYIUESPWXOW-UHFFFAOYSA-N.
| Molecular formula | C26H20N2 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline |
| InChIKey | STTGYIUESPWXOW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC3=C(C=C(N=C3C2=N1)C)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)