cas: 4733-39-5 — see every product listed under this CAS number, including other names
Bathocuproine, >95.0%(T)(HPLC) (CAS 4733-39-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D0711-1G |
| cas | 4733-39-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 374.04 Pln | |
| TCI | 5g | 1554.18 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(T)(HPLC) |
2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline (CAS 4733-39-5) is a chemical compound with the molecular formula C26H20N2 and a molecular weight of 360.4 g/mol. IUPAC name: 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline. InChIKey: STTGYIUESPWXOW-UHFFFAOYSA-N.
| Molecular formula | C26H20N2 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline |
| InChIKey | STTGYIUESPWXOW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC3=C(C=C(N=C3C2=N1)C)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)