cas: 4733-39-5 — see every product listed under this CAS number, including other names
2,9-Dimethyl-4,7-diphenyl-1,10-phenanthroline, 98% (CAS 4733-39-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g, 500g. Offered by: Thermo Scientific (Acros), BLDpharm.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 161340010 |
| cas | 4733-39-5 |
| size | 1g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 418.72 Pln | |
| Thermo Scientific (Acros) | 5g | 1238.34 Pln | |
| BLDpharm | 250mg | 131.09 Pln | |
| BLDpharm | 1g | 203.29 Pln | |
| BLDpharm | 5g | 353.23 Pln | |
| BLDpharm | 10g | 619.81 Pln | |
| BLDpharm | 25g | 1219.60 Pln | |
| BLDpharm | 100g | 4207.43 Pln | |
| BLDpharm | 500g | 16614.17 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline (CAS 4733-39-5) is a chemical compound with the molecular formula C26H20N2 and a molecular weight of 360.4 g/mol. IUPAC name: 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline. InChIKey: STTGYIUESPWXOW-UHFFFAOYSA-N.
| Molecular formula | C26H20N2 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline |
| InChIKey | STTGYIUESPWXOW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC3=C(C=C(N=C3C2=N1)C)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)