Products 2769833-53-4
CAS 2769833-53-4 is the registry number for 2-(tert-Butyl) 6-ethyl 3-chloropyridine-2,6-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-O-tert-butyl 6-O-ethyl 3-chloropyridine-2,6-dicarboxylate (CAS 2769833-53-4) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: 2-O-tert-butyl 6-O-ethyl 3-chloropyridine-2,6-dicarboxylate. InChIKey: XVXLECNOIHFRMV-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO4 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | 2-O-tert-butyl 6-O-ethyl 3-chloropyridine-2,6-dicarboxylate |
| InChIKey | XVXLECNOIHFRMV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(C=C1)Cl)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)