Products 2248287-49-0
CAS 2248287-49-0 is the registry number for 2-((tert-Butoxycarbonyl)amino)-4-chloro-3-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 2248287-49-0) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: 4-chloro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: ODRUYXJQWCYZCN-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO4 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | 4-chloro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | ODRUYXJQWCYZCN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1NC(=O)OC(C)(C)C)C(=O)O)Cl |
Computed by PubChem (NCBI)