cas: 25563-04-6 — see every product listed under this CAS number, including other names
2–(2–(4–Chlorophenoxy)phenyl)acetic acid (CAS 25563-04-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF42304-100mg |
| cas | 25563-04-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 526.83 Pln | |
| GLPBio | 1g | 784.26 Pln | |
| GLPBio | 250mg | 601.72 Pln | |
| GLPBio | 5g | 1561.22 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[2-(4-chlorophenoxy)phenyl]acetic acid (CAS 25563-04-6) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 2-[2-(4-chlorophenoxy)phenyl]acetic acid. InChIKey: ALMJMOPIBISVHZ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 2-[2-(4-chlorophenoxy)phenyl]acetic acid |
| InChIKey | ALMJMOPIBISVHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)