cas: 25563-04-6 — see every product listed under this CAS number, including other names
2-(4-Chloro-phenoxy)-phenylacetic acid, 99.89% (CAS 25563-04-6) is a chemical reagent available from Chemat. Available pack sizes: 250 mg, 1 g, 5 g, 500 mg, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-20152-250 mg |
| cas | 25563-04-6 |
| size | 250 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 250 mg | 361.49 Pln | |
| MedChemExpress | 1 g | 719.08 Pln | |
| MedChemExpress | 5 g | 1606.08 Pln | |
| MedChemExpress | 500 mg | 505.45 Pln | |
| MedChemExpress | 100 mg | 245.39 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.89% |
2-[2-(4-chlorophenoxy)phenyl]acetic acid (CAS 25563-04-6) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 2-[2-(4-chlorophenoxy)phenyl]acetic acid. InChIKey: ALMJMOPIBISVHZ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 2-[2-(4-chlorophenoxy)phenyl]acetic acid |
| InChIKey | ALMJMOPIBISVHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)