cas: 97611-60-4 — see every product listed under this CAS number, including other names
2–Amino–2–(naphthalen–1–yl)acetic acid (CAS 97611-60-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB54329-100 |
| cas | 97611-60-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 615.76 Pln | |
| GLPBio | 10g | 3934.24 Pln | |
| GLPBio | 1g | 1093.17 Pln | |
| GLPBio | 250mg | 751.50 Pln | |
| GLPBio | 5g | 2478.60 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-2-naphthalen-1-ylacetic acid (CAS 97611-60-4) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 2-amino-2-naphthalen-1-ylacetic acid. InChIKey: SCDZHZMVNQDLCM-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2-amino-2-naphthalen-1-ylacetic acid |
| InChIKey | SCDZHZMVNQDLCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(C(=O)O)N |
Computed by PubChem (NCBI)