CAS 97611-60-4 appears in our catalog under these names: Amino-naphthalen-1-yl-acetic acid, 96%, 2–Amino–2–(naphthalen–1–yl)acetic acid, H-DL-Gly(1-Naphthyl)-OH 96%, 2-Amino-2-(naphthalen-1-yl)acetic acid, 96%, 96%, 2-Amino-2-(naphthalen-1-yl)acetic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
2-amino-2-naphthalen-1-ylacetic acid (CAS 97611-60-4) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 2-amino-2-naphthalen-1-ylacetic acid. InChIKey: SCDZHZMVNQDLCM-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2-amino-2-naphthalen-1-ylacetic acid |
| InChIKey | SCDZHZMVNQDLCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(C(=O)O)N |
Computed by PubChem (NCBI)