cas: 408502-23-8 — see every product listed under this CAS number, including other names
2–Methoxy–4–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)pyridine (CAS 408502-23-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 25g, 500mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD17768-1g |
| cas | 408502-23-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 690.65 Pln | |
| GLPBio | 250mg | 540.87 Pln | |
| GLPBio | 25g | 4566.10 Pln | |
| GLPBio | 500mg | 629.80 Pln | |
| GLPBio | 5g | 1533.14 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 408502-23-8) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: RLHAGSICYJAHMN-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO3 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | RLHAGSICYJAHMN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)OC |
Computed by PubChem (NCBI)