cas: 197223-36-2 — see every product listed under this CAS number, including other names
2,3,5,6-TetraMethylphenylboronic acid, 97%, 97% (CAS 197223-36-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113AOF-100mg |
| cas | 197223-36-2 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 496.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,3,5,6-tetramethylphenyl)boronic acid (CAS 197223-36-2) is a chemical compound with the molecular formula C10H15BO2 and a molecular weight of 178.04 g/mol. IUPAC name: (2,3,5,6-tetramethylphenyl)boronic acid. InChIKey: BCMVUEOVWMZJBS-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2 |
|---|---|
| Molecular weight | 178.04 g/mol |
| IUPAC name | (2,3,5,6-tetramethylphenyl)boronic acid |
| InChIKey | BCMVUEOVWMZJBS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC(=C1C)C)C)C)(O)O |
Computed by PubChem (NCBI)