CAS 153624-38-5 appears in our catalog under these names: 4-Isobutylphenylboronic acid, 98%, 4–Isobutylphenylboronic Acid, 4-Isobutylbenzeneboronic acid, 98% . Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 100g, 1g.
[4-(2-methylpropyl)phenyl]boronic acid (CAS 153624-38-5) is a chemical compound with the molecular formula C10H15BO2 and a molecular weight of 178.04 g/mol. IUPAC name: [4-(2-methylpropyl)phenyl]boronic acid. InChIKey: YZSPHVWALUJQNK-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2 |
|---|---|
| Molecular weight | 178.04 g/mol |
| IUPAC name | [4-(2-methylpropyl)phenyl]boronic acid |
| InChIKey | YZSPHVWALUJQNK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CC(C)C)(O)O |
Computed by PubChem (NCBI)