CAS 1415578-24-3 is the registry number for (2-Ethyl-4,6-dimethylphenyl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-ethyl-4,6-dimethylphenyl)boronic acid (CAS 1415578-24-3) is a chemical compound with the molecular formula C10H15BO2 and a molecular weight of 178.04 g/mol. IUPAC name: (2-ethyl-4,6-dimethylphenyl)boronic acid. InChIKey: RBDVFVYOPFWZTR-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2 |
|---|---|
| Molecular weight | 178.04 g/mol |
| IUPAC name | (2-ethyl-4,6-dimethylphenyl)boronic acid |
| InChIKey | RBDVFVYOPFWZTR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1CC)C)C)(O)O |
Computed by PubChem (NCBI)