CAS 153624-42-1 appears in our catalog under these names: 3-Isobutylphenylboronic acid, 96%, 3-Isobutylphenylboronic Acid, (3-Isobutylphenyl)boronic acid, 98+%, (3–(2–METHYLPROPYL)PHENYL)BORONIC ACID. Offered by: Combi-blocks, TRC, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 25mg.
[3-(2-methylpropyl)phenyl]boronic acid (CAS 153624-42-1) is a chemical compound with the molecular formula C10H15BO2 and a molecular weight of 178.04 g/mol. IUPAC name: [3-(2-methylpropyl)phenyl]boronic acid. InChIKey: XBMYWKQRGMFPKZ-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2 |
|---|---|
| Molecular weight | 178.04 g/mol |
| IUPAC name | [3-(2-methylpropyl)phenyl]boronic acid |
| InChIKey | XBMYWKQRGMFPKZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CC(C)C)(O)O |
Computed by PubChem (NCBI)