Products 197223-36-2
CAS 197223-36-2 appears in our catalog under these names: 2,3,5,6-Tetramethylphenylboronic acid, 96%, (2,3,5,6-Tetramethylphenyl)boronic acid, 96%, 2，3，5，6–TetraMethylphenylboronic acid, (2,3,5,6-Tetramethylphenyl)boronic acid 97%, 2，3，5，6-TetraMethylphenylboronic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg.
(2,3,5,6-tetramethylphenyl)boronic acid (CAS 197223-36-2) is a chemical compound with the molecular formula C10H15BO2 and a molecular weight of 178.04 g/mol. IUPAC name: (2,3,5,6-tetramethylphenyl)boronic acid. InChIKey: BCMVUEOVWMZJBS-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2 |
|---|---|
| Molecular weight | 178.04 g/mol |
| IUPAC name | (2,3,5,6-tetramethylphenyl)boronic acid |
| InChIKey | BCMVUEOVWMZJBS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC(=C1C)C)C)C)(O)O |
Computed by PubChem (NCBI)