CAS 1315340-57-8 is the registry number for (4–Ethyl–3,5–dimethylphenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
(4-ethyl-3,5-dimethylphenyl)boronic acid (CAS 1315340-57-8) is a chemical compound with the molecular formula C10H15BO2 and a molecular weight of 178.04 g/mol. IUPAC name: (4-ethyl-3,5-dimethylphenyl)boronic acid. InChIKey: JLFFMHZXQGFWCG-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2 |
|---|---|
| Molecular weight | 178.04 g/mol |
| IUPAC name | (4-ethyl-3,5-dimethylphenyl)boronic acid |
| InChIKey | JLFFMHZXQGFWCG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)CC)C)(O)O |
Computed by PubChem (NCBI)