CAS 89787-13-3 appears in our catalog under these names: (2-tert-Butylphenyl)boronic acid, 95-<97%, (2-tert-Butylphenyl)boronic acid, ≥97-<99%, (2-tert-Butylphenyl)boronic acid, (2-(tert-Butyl)phenyl)boronic acid, 97%, 97%, (2-tert-Butylphenyl)boronic acid, 97%. Offered by: Hoffman Fine Chemicals, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 250mg, 100mg, 1g.
(2-tert-butylphenyl)boronic acid (CAS 89787-13-3) is a chemical compound with the molecular formula C10H15BO2 and a molecular weight of 178.04 g/mol. IUPAC name: (2-tert-butylphenyl)boronic acid. InChIKey: LXLMKMLQQJSOCB-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2 |
|---|---|
| Molecular weight | 178.04 g/mol |
| IUPAC name | (2-tert-butylphenyl)boronic acid |
| InChIKey | LXLMKMLQQJSOCB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C(C)(C)C)(O)O |
Computed by PubChem (NCBI)